C11H23ClN2 — CID 114526657
N-[(2-chlorocyclopentyl)methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 114526657) has the molecular formula C11H23ClN2 and a molecular weight of 218.77 g/mol. Its IUPAC name is N-[(2-chlorocyclopentyl)methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[(2-chlorocyclopentyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114526657 |
| Molecular Formula | C11H23ClN2 |
| Molecular Weight | 218.77 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-[(2-chlorocyclopentyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCC1CCCC1Cl |
| InChI | InChI=1S/C11H23ClN2/c1-14(2)8-4-7-13-9-10-5-3-6-11(10)12/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | DMXVTNGLXXMLGB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.77 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|