About N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine
N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 43180683) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine |
| PubChem CID | 43180683 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCC1CC=CCC1 |
| InChI | InChI=1S/C12H24N2/c1-14(2)10-6-9-13-11-12-7-4-3-5-8-12/h3-4,12-13H,5-11H2,1-2H3 |
| InChIKey | HPWQQSUBDGLJEG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine?
The IUPAC name of N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine (CID 43180683) is N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine.
What is the SMILES notation for N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine?
The canonical SMILES for N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine is CN(C)CCCNCC1CC=CCC1.
What is the InChIKey of N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine?
The InChIKey is HPWQQSUBDGLJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-14(2)10-6-9-13-11-12-7-4-3-5-8-12/h3-4,12-13H,5-11H2,1-2H3.
What are the key properties of N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine?
N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine has a molecular weight of 196.34 g/mol, XLogP of 1.88, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohex-3-en-1-ylmethyl)-N',N'-dimethylpropane-1,3-diamine is sourced from PubChem (CID 43180683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).