C13H22N2O — CID 115572796
N-[2-(cyclohex-3-en-1-ylmethylamino)ethyl]cyclopropanecarboxamide (PubChem CID 115572796) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-[2-(cyclohex-3-en-1-ylmethylamino)ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-(cyclohex-3-en-1-ylmethylamino)ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 115572796 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-[2-(cyclohex-3-en-1-ylmethylamino)ethyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCNCC1CC=CCC1)C1CC1 |
| InChI | InChI=1S/C13H22N2O/c16-13(12-6-7-12)15-9-8-14-10-11-4-2-1-3-5-11/h1-2,11-12,14H,3-10H2,(H,15,16) |
| InChIKey | SZCQZVSKZUHHBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|