C16H29N2O2+ — CID 2187003
1-[[(1S)-cyclohex-3-en-1-yl]methyl]-N-(2-methoxyethyl)piperidin-1-ium-4-carboxamide (PubChem CID 2187003) has the molecular formula C16H29N2O2+ and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-N-(2-methoxyethyl)piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-N-(2-methoxyethyl)piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 2187003 |
| Molecular Formula | C16H29N2O2+ |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-N-(2-methoxyethyl)piperidin-1-ium-4-carboxamide |
| SMILES | COCCNC(=O)C1CC[NH+](C[C@@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C16H28N2O2/c1-20-12-9-17-16(19)15-7-10-18(11-8-15)13-14-5-3-2-4-6-14/h2-3,14-15H,4-13H2,1H3,(H,17,19)/p+1/t14-/m1/s1 |
| InChIKey | IAHKAEQTOHIIJO-CQSZACIVSA-O |
| XLogP | 0.40 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|