C10H19N3O — CID 77030678
3-(cyclohex-3-en-1-ylmethylamino)-N'-hydroxypropanimidamide (PubChem CID 77030678) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-(cyclohex-3-en-1-ylmethylamino)-N'-hydroxypropanimidamide.
| Compound Name | 3-(cyclohex-3-en-1-ylmethylamino)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77030678 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 3-(cyclohex-3-en-1-ylmethylamino)-N'-hydroxypropanimidamide |
| SMILES | NC(CCNCC1CC=CCC1)=NO |
| InChI | InChI=1S/C10H19N3O/c11-10(13-14)6-7-12-8-9-4-2-1-3-5-9/h1-2,9,12,14H,3-8H2,(H2,11,13) |
| InChIKey | JOGXBBHBABFBGR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|