C16H30N4 — CID 114530442
4-ethyl-1-(1-methylimidazol-2-yl)-4-pyrrolidin-1-ylhexan-3-amine (PubChem CID 114530442) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-ethyl-1-(1-methylimidazol-2-yl)-4-pyrrolidin-1-ylhexan-3-amine.
| Compound Name | 4-ethyl-1-(1-methylimidazol-2-yl)-4-pyrrolidin-1-ylhexan-3-amine |
|---|---|
| PubChem CID | 114530442 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 4-ethyl-1-(1-methylimidazol-2-yl)-4-pyrrolidin-1-ylhexan-3-amine |
| SMILES | CCC(CC)(C(N)CCc1nccn1C)N1CCCC1 |
| InChI | InChI=1S/C16H30N4/c1-4-16(5-2,20-11-6-7-12-20)14(17)8-9-15-18-10-13-19(15)3/h10,13-14H,4-9,11-12,17H2,1-3H3 |
| InChIKey | VQHREAOHZIGBMZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |