2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid

C11H18N2O2 — CID 114532954

IUPAC2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid
SMILESCC(CCc1nccn1C)C(C)C(=O)O
InChIInChI=1S/C11H18N2O2/c1-8(9(2)11(14)15)4-5-10-12-6-7-13(10)3/h6-9H,4-5H2,1-3H3,(H,14,15)
InChIKeyWPIXKSSPHHYNHQ-UHFFFAOYSA-N
MW210.28 g/mol
LogP1.71
Rot. Bonds5

About 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid

2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid (PubChem CID 114532954) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid.

Molecular Properties

Compound Name2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid
PubChem CID114532954
Molecular FormulaC11H18N2O2
Molecular Weight210.28 g/mol
Exact Mass210.14
IUPAC Name2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid
SMILESCC(CCc1nccn1C)C(C)C(=O)O
InChIInChI=1S/C11H18N2O2/c1-8(9(2)11(14)15)4-5-10-12-6-7-13(10)3/h6-9H,4-5H2,1-3H3,(H,14,15)
InChIKeyWPIXKSSPHHYNHQ-UHFFFAOYSA-N
XLogP1.71
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.28
LogP ≤ 51.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid?
The IUPAC name of 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid (CID 114532954) is 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid.
What is the SMILES notation for 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid?
The canonical SMILES for 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid is CC(CCc1nccn1C)C(C)C(=O)O.
What is the InChIKey of 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid?
The InChIKey is WPIXKSSPHHYNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-8(9(2)11(14)15)4-5-10-12-6-7-13(10)3/h6-9H,4-5H2,1-3H3,(H,14,15).
What are the key properties of 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid?
2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid has a molecular weight of 210.28 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5-(1-methylimidazol-2-yl)pentanoic acid is sourced from PubChem (CID 114532954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).