C18H16BrClN4O2 — CID 11453346
1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3-chlorophenyl)urea (PubChem CID 11453346) has the molecular formula C18H16BrClN4O2 and a molecular weight of 435.71 g/mol. Its IUPAC name is 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 11453346 |
| Molecular Formula | C18H16BrClN4O2 |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3-chlorophenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2cccc(Cl)c2)cc1-c1c(Br)cnn1C |
| InChI | InChI=1S/C18H16BrClN4O2/c1-24-17(15(19)10-21-24)14-9-13(6-7-16(14)26-2)23-18(25)22-12-5-3-4-11(20)8-12/h3-10H,1-2H3,(H2,22,23,25) |
| InChIKey | BQDQNHMUANFRRQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |