C8H14N2O4S — CID 114533578
2-[cyclopropylsulfamoyl(prop-2-enyl)amino]acetic acid (PubChem CID 114533578) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-[cyclopropylsulfamoyl(prop-2-enyl)amino]acetic acid.
| Compound Name | 2-[cyclopropylsulfamoyl(prop-2-enyl)amino]acetic acid |
|---|---|
| PubChem CID | 114533578 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-[cyclopropylsulfamoyl(prop-2-enyl)amino]acetic acid |
| SMILES | C=CCN(CC(=O)O)S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C8H14N2O4S/c1-2-5-10(6-8(11)12)15(13,14)9-7-3-4-7/h2,7,9H,1,3-6H2,(H,11,12) |
| InChIKey | QFYUCJNUUJYSCV-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|