C13H14FNO5 — CID 114533695
3-[(3-fluoro-5-nitrophenyl)methyl]-2-methyloxolane-3-carboxylic acid (PubChem CID 114533695) has the molecular formula C13H14FNO5 and a molecular weight of 283.25 g/mol. Its IUPAC name is 3-[(3-fluoro-5-nitrophenyl)methyl]-2-methyloxolane-3-carboxylic acid.
| Compound Name | 3-[(3-fluoro-5-nitrophenyl)methyl]-2-methyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 114533695 |
| Molecular Formula | C13H14FNO5 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-[(3-fluoro-5-nitrophenyl)methyl]-2-methyloxolane-3-carboxylic acid |
| SMILES | CC1OCCC1(Cc1cc(F)cc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C13H14FNO5/c1-8-13(12(16)17,2-3-20-8)7-9-4-10(14)6-11(5-9)15(18)19/h4-6,8H,2-3,7H2,1H3,(H,16,17) |
| InChIKey | VQNRDNHCBDBDLR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|