C11H12FNO6S — CID 115980615
3-[(3-fluoro-5-nitrophenyl)methylsulfonyl]-2-methylpropanoic acid (PubChem CID 115980615) has the molecular formula C11H12FNO6S and a molecular weight of 305.28 g/mol. Its IUPAC name is 3-[(3-fluoro-5-nitrophenyl)methylsulfonyl]-2-methylpropanoic acid.
| Compound Name | 3-[(3-fluoro-5-nitrophenyl)methylsulfonyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 115980615 |
| Molecular Formula | C11H12FNO6S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-[(3-fluoro-5-nitrophenyl)methylsulfonyl]-2-methylpropanoic acid |
| SMILES | CC(CS(=O)(=O)Cc1cc(F)cc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C11H12FNO6S/c1-7(11(14)15)5-20(18,19)6-8-2-9(12)4-10(3-8)13(16)17/h2-4,7H,5-6H2,1H3,(H,14,15) |
| InChIKey | SUQKBQSXRVRJMG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|