C11H13NO6S — CID 64915526
2-methyl-3-[(3-nitrophenyl)methylsulfonyl]propanoic acid (PubChem CID 64915526) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-methyl-3-[(3-nitrophenyl)methylsulfonyl]propanoic acid.
| Compound Name | 2-methyl-3-[(3-nitrophenyl)methylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 64915526 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-methyl-3-[(3-nitrophenyl)methylsulfonyl]propanoic acid |
| SMILES | CC(CS(=O)(=O)Cc1cccc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C11H13NO6S/c1-8(11(13)14)6-19(17,18)7-9-3-2-4-10(5-9)12(15)16/h2-5,8H,6-7H2,1H3,(H,13,14) |
| InChIKey | YAOOBWPQDLHOPW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|