C24H32N6O2 — CID 11453381
N-[1-[(Z)-[(cyanoamino)-[(2-methyl-3-pyridinyl)amino]methylidene]amino]-2,2-dimethylpropyl]-4-(4-methoxyphenyl)butanamide (PubChem CID 11453381) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[1-[(Z)-[(cyanoamino)-[(2-methyl-3-pyridinyl)amino]methylidene]amino]-2,2-dimethylpropyl]-4-(4-methoxyphenyl)butanamide.
| Compound Name | N-[1-[(Z)-[(cyanoamino)-[(2-methyl-3-pyridinyl)amino]methylidene]amino]-2,2-dimethylpropyl]-4-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 11453381 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N-[1-[(Z)-[(cyanoamino)-[(2-methyl-3-pyridinyl)amino]methylidene]amino]-2,2-dimethylpropyl]-4-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(CCCC(=O)NC(/N=C(\NC#N)Nc2cccnc2C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32N6O2/c1-17-20(9-7-15-26-17)28-23(27-16-25)30-22(24(2,3)4)29-21(31)10-6-8-18-11-13-19(32-5)14-12-18/h7,9,11-15,22H,6,8,10H2,1-5H3,(H,29,31)(H2,27,28,30) |
| InChIKey | TUVRBDROWOZYTA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|