C10H15F3O4 — CID 114533919
2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxylic acid (PubChem CID 114533919) has the molecular formula C10H15F3O4 and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxylic acid.
| Compound Name | 2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 114533919 |
| Molecular Formula | C10H15F3O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxylic acid |
| SMILES | CC1OCCC1(CCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H15F3O4/c1-7-9(8(14)15,3-5-17-7)2-4-16-6-10(11,12)13/h7H,2-6H2,1H3,(H,14,15) |
| InChIKey | IQOATDHTSISZAU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|