C16H27N3O — CID 114537738
1-(3-methoxyphenyl)-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine (PubChem CID 114537738) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine.
| Compound Name | 1-(3-methoxyphenyl)-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 114537738 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine |
| SMILES | COc1cccc(C(N)CN2CC(C)N(C)C(C)C2)c1 |
| InChI | InChI=1S/C16H27N3O/c1-12-9-19(10-13(2)18(12)3)11-16(17)14-6-5-7-15(8-14)20-4/h5-8,12-13,16H,9-11,17H2,1-4H3 |
| InChIKey | UBJXGCMMDPWPGG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |