C14H24ClN3S — CID 114540403
N-[(5-chlorothiophen-2-yl)methyl]-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine (PubChem CID 114540403) has the molecular formula C14H24ClN3S and a molecular weight of 301.89 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 114540403 |
| Molecular Formula | C14H24ClN3S |
| Molecular Weight | 301.89 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(3,4,5-trimethylpiperazin-1-yl)ethanamine |
| SMILES | CC1CN(CCNCc2ccc(Cl)s2)CC(C)N1C |
| InChI | InChI=1S/C14H24ClN3S/c1-11-9-18(10-12(2)17(11)3)7-6-16-8-13-4-5-14(15)19-13/h4-5,11-12,16H,6-10H2,1-3H3 |
| InChIKey | CSDYIJMZCHXZMF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|