C11H17ClN2OS2 — CID 62554401
N-[(5-chlorothiophen-2-yl)methyl]-2-(1-oxo-1,4-thiazinan-4-yl)ethanamine (PubChem CID 62554401) has the molecular formula C11H17ClN2OS2 and a molecular weight of 292.86 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-(1-oxo-1,4-thiazinan-4-yl)ethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(1-oxo-1,4-thiazinan-4-yl)ethanamine |
|---|---|
| PubChem CID | 62554401 |
| Molecular Formula | C11H17ClN2OS2 |
| Molecular Weight | 292.86 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(1-oxo-1,4-thiazinan-4-yl)ethanamine |
| SMILES | O=S1CCN(CCNCc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C11H17ClN2OS2/c12-11-2-1-10(16-11)9-13-3-4-14-5-7-17(15)8-6-14/h1-2,13H,3-9H2 |
| InChIKey | HQSRQPFDADCLMT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.86 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|