C14H20ClN3OS — CID 126837965
2-[2-[(5-chlorothiophen-2-yl)methylamino]ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-one (PubChem CID 126837965) has the molecular formula C14H20ClN3OS and a molecular weight of 313.85 g/mol. Its IUPAC name is 2-[2-[(5-chlorothiophen-2-yl)methylamino]ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-one.
| Compound Name | 2-[2-[(5-chlorothiophen-2-yl)methylamino]ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-one |
|---|---|
| PubChem CID | 126837965 |
| Molecular Formula | C14H20ClN3OS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[2-[(5-chlorothiophen-2-yl)methylamino]ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-one |
| SMILES | O=C1N(CCNCc2ccc(Cl)s2)CC2CCCCN12 |
| InChI | InChI=1S/C14H20ClN3OS/c15-13-5-4-12(20-13)9-16-6-8-17-10-11-3-1-2-7-18(11)14(17)19/h4-5,11,16H,1-3,6-10H2 |
| InChIKey | QORIAQAEMPPMOV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|