C15H16ClFN2S — CID 103503388
N-[(5-chlorothiophen-2-yl)methyl]-2-(6-fluoro-2,3-dihydroindol-1-yl)ethanamine (PubChem CID 103503388) has the molecular formula C15H16ClFN2S and a molecular weight of 310.83 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-(6-fluoro-2,3-dihydroindol-1-yl)ethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(6-fluoro-2,3-dihydroindol-1-yl)ethanamine |
|---|---|
| PubChem CID | 103503388 |
| Molecular Formula | C15H16ClFN2S |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(6-fluoro-2,3-dihydroindol-1-yl)ethanamine |
| SMILES | Fc1ccc2c(c1)N(CCNCc1ccc(Cl)s1)CC2 |
| InChI | InChI=1S/C15H16ClFN2S/c16-15-4-3-13(20-15)10-18-6-8-19-7-5-11-1-2-12(17)9-14(11)19/h1-4,9,18H,5-8,10H2 |
| InChIKey | LXYRYGATQDREHZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|