C8H15N5 — CID 114541610
1-(3,3-dimethylcyclopentyl)tetrazol-5-amine (PubChem CID 114541610) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclopentyl)tetrazol-5-amine.
| Compound Name | 1-(3,3-dimethylcyclopentyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 114541610 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-(3,3-dimethylcyclopentyl)tetrazol-5-amine |
| SMILES | CC1(C)CCC(n2nnnc2N)C1 |
| InChI | InChI=1S/C8H15N5/c1-8(2)4-3-6(5-8)13-7(9)10-11-12-13/h6H,3-5H2,1-2H3,(H2,9,10,12) |
| InChIKey | MOIVKJSFTVJYOZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |