About N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine
N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine (PubChem CID 114541851) has the molecular formula C14H25N5
and a molecular weight of 263.39 g/mol. Its IUPAC name is N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine |
| PubChem CID | 114541851 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine |
| SMILES | CCCNc1cncc(N2CC(C)N(C)C(C)C2)n1 |
| InChI | InChI=1S/C14H25N5/c1-5-6-16-13-7-15-8-14(17-13)19-9-11(2)18(4)12(3)10-19/h7-8,11-12H,5-6,9-10H2,1-4H3,(H,16,17) |
| InChIKey | KDTQQIXIVIMKFI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine?
The IUPAC name of N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine (CID 114541851) is N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine.
What is the SMILES notation for N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine?
The canonical SMILES for N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine is CCCNc1cncc(N2CC(C)N(C)C(C)C2)n1.
What is the InChIKey of N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine?
The InChIKey is KDTQQIXIVIMKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N5/c1-5-6-16-13-7-15-8-14(17-13)19-9-11(2)18(4)12(3)10-19/h7-8,11-12H,5-6,9-10H2,1-4H3,(H,16,17).
What are the key properties of N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine?
N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine has a molecular weight of 263.39 g/mol, XLogP of 1.83, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-6-(3,4,5-trimethylpiperazin-1-yl)pyrazin-2-amine is sourced from PubChem (CID 114541851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).