C14H20F3N3 — CID 114543002
5-(trifluoromethyl)-2-(3,4,5-trimethylpiperazin-1-yl)aniline (PubChem CID 114543002) has the molecular formula C14H20F3N3 and a molecular weight of 287.33 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-(3,4,5-trimethylpiperazin-1-yl)aniline.
| Compound Name | 5-(trifluoromethyl)-2-(3,4,5-trimethylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 114543002 |
| Molecular Formula | C14H20F3N3 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 5-(trifluoromethyl)-2-(3,4,5-trimethylpiperazin-1-yl)aniline |
| SMILES | CC1CN(c2ccc(C(F)(F)F)cc2N)CC(C)N1C |
| InChI | InChI=1S/C14H20F3N3/c1-9-7-20(8-10(2)19(9)3)13-5-4-11(6-12(13)18)14(15,16)17/h4-6,9-10H,7-8,18H2,1-3H3 |
| InChIKey | ZKVOWYBQOJHXAO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|