C12H25N3 — CID 114544723
3-(aminomethyl)-1-methyl-N-(3-methylcyclopentyl)pyrrolidin-3-amine (PubChem CID 114544723) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 3-(aminomethyl)-1-methyl-N-(3-methylcyclopentyl)pyrrolidin-3-amine.
| Compound Name | 3-(aminomethyl)-1-methyl-N-(3-methylcyclopentyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 114544723 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 3-(aminomethyl)-1-methyl-N-(3-methylcyclopentyl)pyrrolidin-3-amine |
| SMILES | CC1CCC(NC2(CN)CCN(C)C2)C1 |
| InChI | InChI=1S/C12H25N3/c1-10-3-4-11(7-10)14-12(8-13)5-6-15(2)9-12/h10-11,14H,3-9,13H2,1-2H3 |
| InChIKey | ZEBUYTQZVHJGPD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |