C14H27N3O4 — CID 71756459
4-(aminomethyl)-N-cyclopentyl-1-methylpiperidin-4-amine;oxalic acid (PubChem CID 71756459) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-(aminomethyl)-N-cyclopentyl-1-methylpiperidin-4-amine;oxalic acid.
| Compound Name | 4-(aminomethyl)-N-cyclopentyl-1-methylpiperidin-4-amine;oxalic acid |
|---|---|
| PubChem CID | 71756459 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 4-(aminomethyl)-N-cyclopentyl-1-methylpiperidin-4-amine;oxalic acid |
| SMILES | CN1CCC(CN)(NC2CCCC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H25N3.C2H2O4/c1-15-8-6-12(10-13,7-9-15)14-11-4-2-3-5-11;3-1(4)2(5)6/h11,14H,2-10,13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ZAQGDSLIGCEEEW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|