C13H27N3O2S — CID 61065630
N-[4-(aminomethyl)-1-methylpiperidin-4-yl]cyclohexanesulfonamide (PubChem CID 61065630) has the molecular formula C13H27N3O2S and a molecular weight of 289.44 g/mol. Its IUPAC name is N-[4-(aminomethyl)-1-methylpiperidin-4-yl]cyclohexanesulfonamide.
| Compound Name | N-[4-(aminomethyl)-1-methylpiperidin-4-yl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 61065630 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[4-(aminomethyl)-1-methylpiperidin-4-yl]cyclohexanesulfonamide |
| SMILES | CN1CCC(CN)(NS(=O)(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C13H27N3O2S/c1-16-9-7-13(11-14,8-10-16)15-19(17,18)12-5-3-2-4-6-12/h12,15H,2-11,14H2,1H3 |
| InChIKey | ZRIKLUNEISMTME-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |