C7H18N4O2S — CID 28940572
4-(aminomethyl)-1-methyl-4-(sulfamoylamino)piperidine (PubChem CID 28940572) has the molecular formula C7H18N4O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 4-(aminomethyl)-1-methyl-4-(sulfamoylamino)piperidine.
| Compound Name | 4-(aminomethyl)-1-methyl-4-(sulfamoylamino)piperidine |
|---|---|
| PubChem CID | 28940572 |
| Molecular Formula | C7H18N4O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 4-(aminomethyl)-1-methyl-4-(sulfamoylamino)piperidine |
| SMILES | CN1CCC(CN)(NS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C7H18N4O2S/c1-11-4-2-7(6-8,3-5-11)10-14(9,12)13/h10H,2-6,8H2,1H3,(H2,9,12,13) |
| InChIKey | AIRRDGBXQVOVKY-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |