C7H13F2NO2S — CID 114545159
1,1-difluoro-N-(3-methylcyclopentyl)methanesulfonamide (PubChem CID 114545159) has the molecular formula C7H13F2NO2S and a molecular weight of 213.25 g/mol. Its IUPAC name is 1,1-difluoro-N-(3-methylcyclopentyl)methanesulfonamide.
| Compound Name | 1,1-difluoro-N-(3-methylcyclopentyl)methanesulfonamide |
|---|---|
| PubChem CID | 114545159 |
| Molecular Formula | C7H13F2NO2S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1,1-difluoro-N-(3-methylcyclopentyl)methanesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)C(F)F)C1 |
| InChI | InChI=1S/C7H13F2NO2S/c1-5-2-3-6(4-5)10-13(11,12)7(8)9/h5-7,10H,2-4H2,1H3 |
| InChIKey | AADQLSGQNZXKQP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |