C10H18F3NO2S — CID 114545331
4,4,4-trifluoro-N-(3-methylcyclopentyl)butane-1-sulfonamide (PubChem CID 114545331) has the molecular formula C10H18F3NO2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(3-methylcyclopentyl)butane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-(3-methylcyclopentyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 114545331 |
| Molecular Formula | C10H18F3NO2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4,4,4-trifluoro-N-(3-methylcyclopentyl)butane-1-sulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H18F3NO2S/c1-8-3-4-9(7-8)14-17(15,16)6-2-5-10(11,12)13/h8-9,14H,2-7H2,1H3 |
| InChIKey | WEBRTVBGGPEBNS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |