C13H24N2O — CID 114546332
N-(3,3-dimethylcyclopentyl)-2-pyrrolidin-2-ylacetamide (PubChem CID 114546332) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 114546332 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-2-pyrrolidin-2-ylacetamide |
| SMILES | CC1(C)CCC(NC(=O)CC2CCCN2)C1 |
| InChI | InChI=1S/C13H24N2O/c1-13(2)6-5-11(9-13)15-12(16)8-10-4-3-7-14-10/h10-11,14H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | CNUICHSBXDINSL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |