C11H19N3O2 — CID 63660873
N-(6-oxopiperidin-3-yl)-2-pyrrolidin-2-ylacetamide (PubChem CID 63660873) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(6-oxopiperidin-3-yl)-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-(6-oxopiperidin-3-yl)-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 63660873 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-(6-oxopiperidin-3-yl)-2-pyrrolidin-2-ylacetamide |
| SMILES | O=C1CCC(NC(=O)CC2CCCN2)CN1 |
| InChI | InChI=1S/C11H19N3O2/c15-10-4-3-9(7-13-10)14-11(16)6-8-2-1-5-12-8/h8-9,12H,1-7H2,(H,13,15)(H,14,16) |
| InChIKey | KBANDKYWDAZGAJ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |