C11H19N3S — CID 114547755
N-(3-methylcyclopentyl)-3-propyl-1,2,4-thiadiazol-5-amine (PubChem CID 114547755) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is N-(3-methylcyclopentyl)-3-propyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(3-methylcyclopentyl)-3-propyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 114547755 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-(3-methylcyclopentyl)-3-propyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCCc1nsc(NC2CCC(C)C2)n1 |
| InChI | InChI=1S/C11H19N3S/c1-3-4-10-13-11(15-14-10)12-9-6-5-8(2)7-9/h8-9H,3-7H2,1-2H3,(H,12,13,14) |
| InChIKey | IHNXZEOQAMQLRF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |