C10H18N4S — CID 65275895
N-piperidin-3-yl-3-propyl-1,2,4-thiadiazol-5-amine (PubChem CID 65275895) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is N-piperidin-3-yl-3-propyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-piperidin-3-yl-3-propyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65275895 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-piperidin-3-yl-3-propyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCCc1nsc(NC2CCCNC2)n1 |
| InChI | InChI=1S/C10H18N4S/c1-2-4-9-13-10(15-14-9)12-8-5-3-6-11-7-8/h8,11H,2-7H2,1H3,(H,12,13,14) |
| InChIKey | QGZXEWSHZBBMIU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |