C11H20N4S — CID 65275948
3-tert-butyl-N-piperidin-3-yl-1,2,4-thiadiazol-5-amine (PubChem CID 65275948) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 3-tert-butyl-N-piperidin-3-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-tert-butyl-N-piperidin-3-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65275948 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-tert-butyl-N-piperidin-3-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)(C)c1nsc(NC2CCCNC2)n1 |
| InChI | InChI=1S/C11H20N4S/c1-11(2,3)9-14-10(16-15-9)13-8-5-4-6-12-7-8/h8,12H,4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | SXTAUHYSQVQWGA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |