About 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid
2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid (PubChem CID 114548192) has the molecular formula C13H18N2O3S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid |
| PubChem CID | 114548192 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid |
| SMILES | CC1(C)CCC(NC(=O)Nc2sccc2C(=O)O)C1 |
| InChI | InChI=1S/C13H18N2O3S/c1-13(2)5-3-8(7-13)14-12(18)15-10-9(11(16)17)4-6-19-10/h4,6,8H,3,5,7H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | CAFXGUOYCLLPAX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid?
The IUPAC name of 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid (CID 114548192) is 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid.
What is the SMILES notation for 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid?
The canonical SMILES for 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid is CC1(C)CCC(NC(=O)Nc2sccc2C(=O)O)C1.
What is the InChIKey of 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid?
The InChIKey is CAFXGUOYCLLPAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-13(2)5-3-8(7-13)14-12(18)15-10-9(11(16)17)4-6-19-10/h4,6,8H,3,5,7H2,1-2H3,(H,16,17)(H2,14,15,18).
What are the key properties of 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid?
2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid has a molecular weight of 282.36 g/mol, XLogP of 3.15, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,3-dimethylcyclopentyl)carbamoylamino]thiophene-3-carboxylic acid is sourced from PubChem (CID 114548192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).