About 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid
5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid (PubChem CID 114548981) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid |
| PubChem CID | 114548981 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid |
| SMILES | Cc1ccc(NC(=O)NC2CCC(C)(C)C2)cc1C(=O)O |
| InChI | InChI=1S/C16H22N2O3/c1-10-4-5-11(8-13(10)14(19)20)17-15(21)18-12-6-7-16(2,3)9-12/h4-5,8,12H,6-7,9H2,1-3H3,(H,19,20)(H2,17,18,21) |
| InChIKey | MCDGAYASGBGDRG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid?
The IUPAC name of 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid (CID 114548981) is 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid.
What is the SMILES notation for 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid?
The canonical SMILES for 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid is Cc1ccc(NC(=O)NC2CCC(C)(C)C2)cc1C(=O)O.
What is the InChIKey of 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid?
The InChIKey is MCDGAYASGBGDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3/c1-10-4-5-11(8-13(10)14(19)20)17-15(21)18-12-6-7-16(2,3)9-12/h4-5,8,12H,6-7,9H2,1-3H3,(H,19,20)(H2,17,18,21).
What are the key properties of 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid?
5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid has a molecular weight of 290.36 g/mol, XLogP of 3.39, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,3-dimethylcyclopentyl)carbamoylamino]-2-methylbenzoic acid is sourced from PubChem (CID 114548981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).