C13H15IN2S — CID 114548270
6-iodo-3-(3-methylcyclopentyl)-1H-benzimidazole-2-thione (PubChem CID 114548270) has the molecular formula C13H15IN2S and a molecular weight of 358.25 g/mol. Its IUPAC name is 6-iodo-3-(3-methylcyclopentyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-iodo-3-(3-methylcyclopentyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114548270 |
| Molecular Formula | C13H15IN2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 6-iodo-3-(3-methylcyclopentyl)-1H-benzimidazole-2-thione |
| SMILES | CC1CCC(n2c(=S)[nH]c3cc(I)ccc32)C1 |
| InChI | InChI=1S/C13H15IN2S/c1-8-2-4-10(6-8)16-12-5-3-9(14)7-11(12)15-13(16)17/h3,5,7-8,10H,2,4,6H2,1H3,(H,15,17) |
| InChIKey | JHXDYUCXKRCVLI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|