C15H19BrN2S — CID 64732898
6-bromo-3-(3,5-dimethylcyclohexyl)-1H-benzimidazole-2-thione (PubChem CID 64732898) has the molecular formula C15H19BrN2S and a molecular weight of 339.30 g/mol. Its IUPAC name is 6-bromo-3-(3,5-dimethylcyclohexyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-3-(3,5-dimethylcyclohexyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 64732898 |
| Molecular Formula | C15H19BrN2S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 6-bromo-3-(3,5-dimethylcyclohexyl)-1H-benzimidazole-2-thione |
| SMILES | CC1CC(C)CC(n2c(=S)[nH]c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C15H19BrN2S/c1-9-5-10(2)7-12(6-9)18-14-4-3-11(16)8-13(14)17-15(18)19/h3-4,8-10,12H,5-7H2,1-2H3,(H,17,19) |
| InChIKey | DFPUNWJRLAHEFB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|