C17H23BrN2S — CID 103967476
6-bromo-3-(3,3,5,5-tetramethylcyclohexyl)-1H-benzimidazole-2-thione (PubChem CID 103967476) has the molecular formula C17H23BrN2S and a molecular weight of 367.36 g/mol. Its IUPAC name is 6-bromo-3-(3,3,5,5-tetramethylcyclohexyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-3-(3,3,5,5-tetramethylcyclohexyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 103967476 |
| Molecular Formula | C17H23BrN2S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 6-bromo-3-(3,3,5,5-tetramethylcyclohexyl)-1H-benzimidazole-2-thione |
| SMILES | CC1(C)CC(n2c(=S)[nH]c3cc(Br)ccc32)CC(C)(C)C1 |
| InChI | InChI=1S/C17H23BrN2S/c1-16(2)8-12(9-17(3,4)10-16)20-14-6-5-11(18)7-13(14)19-15(20)21/h5-7,12H,8-10H2,1-4H3,(H,19,21) |
| InChIKey | ANWAQUDXKOHCFV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|