About 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole
2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole (PubChem CID 114548640) has the molecular formula C16H19ClF2N2
and a molecular weight of 312.79 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole.
Molecular Properties
| Compound Name | 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole |
| PubChem CID | 114548640 |
| Molecular Formula | C16H19ClF2N2 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole |
| SMILES | CC1(C)CCC(n2c(CCCl)nc3ccc(F)c(F)c32)C1 |
| InChI | InChI=1S/C16H19ClF2N2/c1-16(2)7-5-10(9-16)21-13(6-8-17)20-12-4-3-11(18)14(19)15(12)21/h3-4,10H,5-9H2,1-2H3 |
| InChIKey | QRIKGABWRJBNIM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole?
The IUPAC name of 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole (CID 114548640) is 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole.
What is the SMILES notation for 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole?
The canonical SMILES for 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole is CC1(C)CCC(n2c(CCCl)nc3ccc(F)c(F)c32)C1.
What is the InChIKey of 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole?
The InChIKey is QRIKGABWRJBNIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClF2N2/c1-16(2)7-5-10(9-16)21-13(6-8-17)20-12-4-3-11(18)14(19)15(12)21/h3-4,10H,5-9H2,1-2H3.
What are the key properties of 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole?
2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole has a molecular weight of 312.79 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloroethyl)-1-(3,3-dimethylcyclopentyl)-6,7-difluorobenzimidazole is sourced from PubChem (CID 114548640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).