C13H13ClF2N2O — CID 80713679
2-(2-chloroethyl)-6,7-difluoro-1-(oxolan-3-yl)benzimidazole (PubChem CID 80713679) has the molecular formula C13H13ClF2N2O and a molecular weight of 286.71 g/mol. Its IUPAC name is 2-(2-chloroethyl)-6,7-difluoro-1-(oxolan-3-yl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-6,7-difluoro-1-(oxolan-3-yl)benzimidazole |
|---|---|
| PubChem CID | 80713679 |
| Molecular Formula | C13H13ClF2N2O |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-(2-chloroethyl)-6,7-difluoro-1-(oxolan-3-yl)benzimidazole |
| SMILES | Fc1ccc2nc(CCCl)n(C3CCOC3)c2c1F |
| InChI | InChI=1S/C13H13ClF2N2O/c14-5-3-11-17-10-2-1-9(15)12(16)13(10)18(11)8-4-6-19-7-8/h1-2,8H,3-7H2 |
| InChIKey | KAJROUPUXRQETF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|