C21H18F5N7O3 — CID 11455031
2,4-difluoro-N-methoxy-5-[[5-propan-2-yl-6-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide (PubChem CID 11455031) has the molecular formula C21H18F5N7O3 and a molecular weight of 511.41 g/mol. Its IUPAC name is 2,4-difluoro-N-methoxy-5-[[5-propan-2-yl-6-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide.
| Compound Name | 2,4-difluoro-N-methoxy-5-[[5-propan-2-yl-6-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 11455031 |
| Molecular Formula | C21H18F5N7O3 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 2,4-difluoro-N-methoxy-5-[[5-propan-2-yl-6-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide |
| SMILES | CONC(=O)c1cc(Nc2ncnn3cc(-c4nnc(CC(F)(F)F)o4)c(C(C)C)c23)c(F)cc1F |
| InChI | InChI=1S/C21H18F5N7O3/c1-9(2)16-11(20-31-30-15(36-20)6-21(24,25)26)7-33-17(16)18(27-8-28-33)29-14-4-10(19(34)32-35-3)12(22)5-13(14)23/h4-5,7-9H,6H2,1-3H3,(H,32,34)(H,27,28,29) |
| InChIKey | KNCMFVBGBJGBGI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|