C15H18ClNO3S — CID 114550771
2-chloro-4-(3-hydroxyprop-1-ynyl)-N-(3-methylcyclopentyl)benzenesulfonamide (PubChem CID 114550771) has the molecular formula C15H18ClNO3S and a molecular weight of 327.83 g/mol. Its IUPAC name is 2-chloro-4-(3-hydroxyprop-1-ynyl)-N-(3-methylcyclopentyl)benzenesulfonamide.
| Compound Name | 2-chloro-4-(3-hydroxyprop-1-ynyl)-N-(3-methylcyclopentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114550771 |
| Molecular Formula | C15H18ClNO3S |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-chloro-4-(3-hydroxyprop-1-ynyl)-N-(3-methylcyclopentyl)benzenesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc(C#CCO)cc2Cl)C1 |
| InChI | InChI=1S/C15H18ClNO3S/c1-11-4-6-13(9-11)17-21(19,20)15-7-5-12(3-2-8-18)10-14(15)16/h5,7,10-11,13,17-18H,4,6,8-9H2,1H3 |
| InChIKey | QWHYZFQTEIPIOI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|