C12H14ClNO5S2 — CID 60925262
2-chloro-4-(3-hydroxyprop-1-ynyl)-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 60925262) has the molecular formula C12H14ClNO5S2 and a molecular weight of 351.83 g/mol. Its IUPAC name is 2-chloro-4-(3-hydroxyprop-1-ynyl)-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 2-chloro-4-(3-hydroxyprop-1-ynyl)-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60925262 |
| Molecular Formula | C12H14ClNO5S2 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2-chloro-4-(3-hydroxyprop-1-ynyl)-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1ccc(C#CCO)cc1Cl |
| InChI | InChI=1S/C12H14ClNO5S2/c1-20(16,17)8-6-14-21(18,19)12-5-4-10(3-2-7-15)9-11(12)13/h4-5,9,14-15H,6-8H2,1H3 |
| InChIKey | QYHLOXVELGXRFD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|