C27H50O6SSi — CID 11455373
(3R,4R,6S,7R,8aR)-3-[(1R)-1-[(2R,5S)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypentyl]oxolan-2-yl]ethyl]-4,6-dimethyl-1,1-dioxo-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol (PubChem CID 11455373) has the molecular formula C27H50O6SSi and a molecular weight of 530.84 g/mol. Its IUPAC name is (3R,4R,6S,7R,8aR)-3-[(1R)-1-[(2R,5S)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypentyl]oxolan-2-yl]ethyl]-4,6-dimethyl-1,1-dioxo-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol.
| Compound Name | (3R,4R,6S,7R,8aR)-3-[(1R)-1-[(2R,5S)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypentyl]oxolan-2-yl]ethyl]-4,6-dimethyl-1,1-dioxo-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol |
|---|---|
| PubChem CID | 11455373 |
| Molecular Formula | C27H50O6SSi |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | (3R,4R,6S,7R,8aR)-3-[(1R)-1-[(2R,5S)-5-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypentyl]oxolan-2-yl]ethyl]-4,6-dimethyl-1,1-dioxo-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol |
| SMILES | CCC[C@@H](C[C@@H]1CC[C@H]([C@@H](C)[C@@H]2OS(=O)(=O)[C@@H]3C[C@@H](O)[C@@H](C)C=C3[C@H]2C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O6SSi/c1-10-11-21(33-35(8,9)27(5,6)7)15-20-12-13-24(31-20)19(4)26-18(3)22-14-17(2)23(28)16-25(22)34(29,30)32-26/h14,17-21,23-26,28H,10-13,15-16H2,1-9H3/t17-,18+,19+,20-,21-,23+,24+,25+,26+/m0/s1 |
| InChIKey | IDACMKCZYVSXJH-DYRYZNJYSA-N |
| XLogP | 5.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|