C8H15N3O — CID 114554585
4-amino-3-(2-methylpyrazol-3-yl)butan-1-ol (PubChem CID 114554585) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 4-amino-3-(2-methylpyrazol-3-yl)butan-1-ol.
| Compound Name | 4-amino-3-(2-methylpyrazol-3-yl)butan-1-ol |
|---|---|
| PubChem CID | 114554585 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4-amino-3-(2-methylpyrazol-3-yl)butan-1-ol |
| SMILES | Cn1nccc1C(CN)CCO |
| InChI | InChI=1S/C8H15N3O/c1-11-8(2-4-10-11)7(6-9)3-5-12/h2,4,7,12H,3,5-6,9H2,1H3 |
| InChIKey | ATIUOVNOVNMPRE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |