C9H7Cl2IN4 — CID 114556671
4,6-dichloro-2-(2-ethylpyrazol-3-yl)-5-iodopyrimidine (PubChem CID 114556671) has the molecular formula C9H7Cl2IN4 and a molecular weight of 368.99 g/mol. Its IUPAC name is 4,6-dichloro-2-(2-ethylpyrazol-3-yl)-5-iodopyrimidine.
| Compound Name | 4,6-dichloro-2-(2-ethylpyrazol-3-yl)-5-iodopyrimidine |
|---|---|
| PubChem CID | 114556671 |
| Molecular Formula | C9H7Cl2IN4 |
| Molecular Weight | 368.99 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | 4,6-dichloro-2-(2-ethylpyrazol-3-yl)-5-iodopyrimidine |
| SMILES | CCn1nccc1-c1nc(Cl)c(I)c(Cl)n1 |
| InChI | InChI=1S/C9H7Cl2IN4/c1-2-16-5(3-4-13-16)9-14-7(10)6(12)8(11)15-9/h3-4H,2H2,1H3 |
| InChIKey | RZUUKBPNMNOAOS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.99 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|