C8H14N6 — CID 114558063
2-[(E)-(2-propylpyrazol-3-yl)methylideneamino]guanidine (PubChem CID 114558063) has the molecular formula C8H14N6 and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-[(E)-(2-propylpyrazol-3-yl)methylideneamino]guanidine.
| Compound Name | 2-[(E)-(2-propylpyrazol-3-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 114558063 |
| Molecular Formula | C8H14N6 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-[(E)-(2-propylpyrazol-3-yl)methylideneamino]guanidine |
| SMILES | CCCn1nccc1/C=N/N=C(N)N |
| InChI | InChI=1S/C8H14N6/c1-2-5-14-7(3-4-12-14)6-11-13-8(9)10/h3-4,6H,2,5H2,1H3,(H4,9,10,13)/b11-6+ |
| InChIKey | KFVYENCKKSTQLO-IZZDOVSWSA-N |
| XLogP | -0.10 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|