C12H19N3 — CID 114558274
N-[(E)-3-(2-propylpyrazol-3-yl)prop-2-enyl]cyclopropanamine (PubChem CID 114558274) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is N-[(E)-3-(2-propylpyrazol-3-yl)prop-2-enyl]cyclopropanamine.
| Compound Name | N-[(E)-3-(2-propylpyrazol-3-yl)prop-2-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 114558274 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-[(E)-3-(2-propylpyrazol-3-yl)prop-2-enyl]cyclopropanamine |
| SMILES | CCCn1nccc1/C=C/CNC1CC1 |
| InChI | InChI=1S/C12H19N3/c1-2-10-15-12(7-9-14-15)4-3-8-13-11-5-6-11/h3-4,7,9,11,13H,2,5-6,8,10H2,1H3/b4-3+ |
| InChIKey | AYWMTMJQNCWRHR-ONEGZZNKSA-N |
| XLogP | 2.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |