C10H13NO — CID 79347716
N-[3-(furan-3-yl)prop-2-enyl]cyclopropanamine (PubChem CID 79347716) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is N-[3-(furan-3-yl)prop-2-enyl]cyclopropanamine.
| Compound Name | N-[3-(furan-3-yl)prop-2-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 79347716 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N-[3-(furan-3-yl)prop-2-enyl]cyclopropanamine |
| SMILES | C(=Cc1ccoc1)CNC1CC1 |
| InChI | InChI=1S/C10H13NO/c1(6-11-10-3-4-10)2-9-5-7-12-8-9/h1-2,5,7-8,10-11H,3-4,6H2 |
| InChIKey | GXCDBAVPELKJQO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |