C34H29N4OPS — CID 11455901
2-anilino-3-[(triphenyl-λ5-phosphanylidene)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 11455901) has the molecular formula C34H29N4OPS and a molecular weight of 572.67 g/mol. Its IUPAC name is 2-anilino-3-[(triphenyl-λ5-phosphanylidene)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-anilino-3-[(triphenyl-λ5-phosphanylidene)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11455901 |
| Molecular Formula | C34H29N4OPS |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 2-anilino-3-[(triphenyl-λ5-phosphanylidene)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c3c(sc2nc(Nc2ccccc2)n1N=P(c1ccccc1)(c1ccccc1)c1ccccc1)CCCC3 |
| InChI | InChI=1S/C34H29N4OPS/c39-33-31-29-23-13-14-24-30(29)41-32(31)36-34(35-25-15-5-1-6-16-25)38(33)37-40(26-17-7-2-8-18-26,27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22H,13-14,23-24H2,(H,35,36) |
| InChIKey | TYRVCZMVRIHCLQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|